C19H25BrClN5O2 — CID 142965353
N-(4-bromo-5-methyl-1H-pyrazol-3-yl)-2-chlorobenzamide;N-(2-piperidin-1-ylethyl)formamide (PubChem CID 142965353) has the molecular formula C19H25BrClN5O2 and a molecular weight of 470.80 g/mol. Its IUPAC name is N-(4-bromo-5-methyl-1H-pyrazol-3-yl)-2-chlorobenzamide;N-(2-piperidin-1-ylethyl)formamide.
| Compound Name | N-(4-bromo-5-methyl-1H-pyrazol-3-yl)-2-chlorobenzamide;N-(2-piperidin-1-ylethyl)formamide |
|---|---|
| PubChem CID | 142965353 |
| Molecular Formula | C19H25BrClN5O2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-(4-bromo-5-methyl-1H-pyrazol-3-yl)-2-chlorobenzamide;N-(2-piperidin-1-ylethyl)formamide |
| SMILES | Cc1[nH]nc(NC(=O)c2ccccc2Cl)c1Br.O=CNCCN1CCCCC1 |
| InChI | InChI=1S/C11H9BrClN3O.C8H16N2O/c1-6-9(12)10(16-15-6)14-11(17)7-4-2-3-5-8(7)13;11-8-9-4-7-10-5-2-1-3-6-10/h2-5H,1H3,(H2,14,15,16,17);8H,1-7H2,(H,9,11) |
| InChIKey | CDZNRJBEZIDXIQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|