C14H15BrN5O3P — CID 142965620
N-[(2S)-1-amino-1-oxopropan-2-yl]-4-bromo-3-[(2-phosphanylbenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 142965620) has the molecular formula C14H15BrN5O3P and a molecular weight of 412.18 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxopropan-2-yl]-4-bromo-3-[(2-phosphanylbenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-bromo-3-[(2-phosphanylbenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 142965620 |
| Molecular Formula | C14H15BrN5O3P |
| Molecular Weight | 412.18 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-bromo-3-[(2-phosphanylbenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1[nH]nc(NC(=O)c2ccccc2P)c1Br)C(N)=O |
| InChI | InChI=1S/C14H15BrN5O3P/c1-6(11(16)21)17-14(23)10-9(15)12(20-19-10)18-13(22)7-4-2-3-5-8(7)24/h2-6H,24H2,1H3,(H2,16,21)(H,17,23)(H2,18,19,20,22)/t6-/m0/s1 |
| InChIKey | WBCNNBXEDGCUFK-LURJTMIESA-N |
| XLogP | 0.53 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|