About (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine
(1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine (PubChem CID 142965819) has the molecular formula C11H14FN3
and a molecular weight of 207.25 g/mol. Its IUPAC name is (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine |
| PubChem CID | 142965819 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C(\N)N(N)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FN3/c1-3-8(2)11(13)15(14)10-6-4-9(12)5-7-10/h3-7H,1,13-14H2,2H3/b11-8+ |
| InChIKey | WWGPAEWETAIYAW-DHZHZOJOSA-N |
| XLogP | 1.88 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine?
The IUPAC name of (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine (CID 142965819) is (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine?
The canonical SMILES for (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine is C=C/C(C)=C(\N)N(N)c1ccc(F)cc1.
What is the InChIKey of (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine?
The InChIKey is WWGPAEWETAIYAW-DHZHZOJOSA-N. The full InChI is InChI=1S/C11H14FN3/c1-3-8(2)11(13)15(14)10-6-4-9(12)5-7-10/h3-7H,1,13-14H2,2H3/b11-8+.
What are the key properties of (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine?
(1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine has a molecular weight of 207.25 g/mol, XLogP of 1.88, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(N-amino-4-fluoroanilino)-2-methylbuta-1,3-dien-1-amine is sourced from PubChem (CID 142965819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).