N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen

C4H12N2O2 — CID 142966371

IUPACN-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen
SMILESCC(=O)NC(C)NO.[H][H]
InChIInChI=1S/C4H10N2O2.H2/c1-3(6-8)5-4(2)7;/h3,6,8H,1-2H3,(H,5,7);1H
InChIKeyMUWDGJFNYDXYHX-UHFFFAOYSA-N
MW120.15 g/mol
LogP-0.31
Rot. Bonds2

About N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen

N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen (PubChem CID 142966371) has the molecular formula C4H12N2O2 and a molecular weight of 120.15 g/mol. Its IUPAC name is N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen.

Molecular Properties

Compound NameN-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen
PubChem CID142966371
Molecular FormulaC4H12N2O2
Molecular Weight120.15 g/mol
Exact Mass120.09
IUPAC NameN-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen
SMILESCC(=O)NC(C)NO.[H][H]
InChIInChI=1S/C4H10N2O2.H2/c1-3(6-8)5-4(2)7;/h3,6,8H,1-2H3,(H,5,7);1H
InChIKeyMUWDGJFNYDXYHX-UHFFFAOYSA-N
XLogP-0.31
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.15
LogP ≤ 5-0.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen?
The IUPAC name of N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen (CID 142966371) is N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen.
What is the SMILES notation for N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen?
The canonical SMILES for N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen is CC(=O)NC(C)NO.[H][H].
What is the InChIKey of N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen?
The InChIKey is MUWDGJFNYDXYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2.H2/c1-3(6-8)5-4(2)7;/h3,6,8H,1-2H3,(H,5,7);1H.
What are the key properties of N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen?
N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen has a molecular weight of 120.15 g/mol, XLogP of -0.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(hydroxyamino)ethyl]acetamide;molecular hydrogen is sourced from PubChem (CID 142966371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).