About N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide
N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide (PubChem CID 142967054) has the molecular formula C15H16F2N4O
and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide.
Molecular Properties
| Compound Name | N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide |
| PubChem CID | 142967054 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide |
| SMILES | CC(=O)NC/C(N)=C/Nc1cc(F)c(-n2cccc2)c(F)c1 |
| InChI | InChI=1S/C15H16F2N4O/c1-10(22)19-8-11(18)9-20-12-6-13(16)15(14(17)7-12)21-4-2-3-5-21/h2-7,9,20H,8,18H2,1H3,(H,19,22)/b11-9- |
| InChIKey | XWFYEYHOUBZGLJ-LUAWRHEFSA-N |
| XLogP | 2.10 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide?
The IUPAC name of N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide (CID 142967054) is N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide.
What is the SMILES notation for N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide?
The canonical SMILES for N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide is CC(=O)NC/C(N)=C/Nc1cc(F)c(-n2cccc2)c(F)c1.
What is the InChIKey of N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide?
The InChIKey is XWFYEYHOUBZGLJ-LUAWRHEFSA-N. The full InChI is InChI=1S/C15H16F2N4O/c1-10(22)19-8-11(18)9-20-12-6-13(16)15(14(17)7-12)21-4-2-3-5-21/h2-7,9,20H,8,18H2,1H3,(H,19,22)/b11-9-.
What are the key properties of N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide?
N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide has a molecular weight of 306.32 g/mol, XLogP of 2.10, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-amino-3-(3,5-difluoro-4-pyrrol-1-ylanilino)prop-2-enyl]acetamide is sourced from PubChem (CID 142967054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).