C13H15FN6S — CID 142967119
N-[(Z)-2-amino-3-[3-fluoro-4-(1,2,4-triazol-1-yl)anilino]prop-2-enyl]ethanethioamide (PubChem CID 142967119) has the molecular formula C13H15FN6S and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(Z)-2-amino-3-[3-fluoro-4-(1,2,4-triazol-1-yl)anilino]prop-2-enyl]ethanethioamide.
| Compound Name | N-[(Z)-2-amino-3-[3-fluoro-4-(1,2,4-triazol-1-yl)anilino]prop-2-enyl]ethanethioamide |
|---|---|
| PubChem CID | 142967119 |
| Molecular Formula | C13H15FN6S |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-[(Z)-2-amino-3-[3-fluoro-4-(1,2,4-triazol-1-yl)anilino]prop-2-enyl]ethanethioamide |
| SMILES | CC(=S)NC/C(N)=C/Nc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C13H15FN6S/c1-9(21)17-5-10(15)6-18-11-2-3-13(12(14)4-11)20-8-16-7-19-20/h2-4,6-8,18H,5,15H2,1H3,(H,17,21)/b10-6- |
| InChIKey | KSEFAYRMXDZAPH-POHAHGRESA-N |
| XLogP | 1.56 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|