C10H11F2N3 — CID 142967125
(1E,3E,5Z)-1,5-difluoro-6-imidazol-1-ylhepta-1,3,5-trien-3-amine (PubChem CID 142967125) has the molecular formula C10H11F2N3 and a molecular weight of 211.22 g/mol. Its IUPAC name is (1E,3E,5Z)-1,5-difluoro-6-imidazol-1-ylhepta-1,3,5-trien-3-amine.
| Compound Name | (1E,3E,5Z)-1,5-difluoro-6-imidazol-1-ylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 142967125 |
| Molecular Formula | C10H11F2N3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | (1E,3E,5Z)-1,5-difluoro-6-imidazol-1-ylhepta-1,3,5-trien-3-amine |
| SMILES | C/C(=C(F)\C=C(N)/C=C/F)n1ccnc1 |
| InChI | InChI=1S/C10H11F2N3/c1-8(15-5-4-14-7-15)10(12)6-9(13)2-3-11/h2-7H,13H2,1H3/b3-2+,9-6+,10-8- |
| InChIKey | LNKPSDIFUWQZIQ-VPWHWIFMSA-N |
| XLogP | 2.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|