C25H30F2N2OS — CID 142967240
4-(1,1-difluoroethyl)-6-[[4-(3,3-dimethylbutylamino)sulfanyl-2-methylphenyl]methyl]-1H-quinolin-2-one (PubChem CID 142967240) has the molecular formula C25H30F2N2OS and a molecular weight of 444.59 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-6-[[4-(3,3-dimethylbutylamino)sulfanyl-2-methylphenyl]methyl]-1H-quinolin-2-one.
| Compound Name | 4-(1,1-difluoroethyl)-6-[[4-(3,3-dimethylbutylamino)sulfanyl-2-methylphenyl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142967240 |
| Molecular Formula | C25H30F2N2OS |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-(1,1-difluoroethyl)-6-[[4-(3,3-dimethylbutylamino)sulfanyl-2-methylphenyl]methyl]-1H-quinolin-2-one |
| SMILES | Cc1cc(SNCCC(C)(C)C)ccc1Cc1ccc2[nH]c(=O)cc(C(C)(F)F)c2c1 |
| InChI | InChI=1S/C25H30F2N2OS/c1-16-12-19(31-28-11-10-24(2,3)4)8-7-18(16)13-17-6-9-22-20(14-17)21(25(5,26)27)15-23(30)29-22/h6-9,12,14-15,28H,10-11,13H2,1-5H3,(H,29,30) |
| InChIKey | NEJZMUFPVZWGPZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|