C31H30F2N2O5S — CID 142967284
ethyl 3-[[4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxo-1H-quinolin-6-yl]methyl]phenyl]sulfonylamino]-3-phenylpropanoate (PubChem CID 142967284) has the molecular formula C31H30F2N2O5S and a molecular weight of 580.65 g/mol. Its IUPAC name is ethyl 3-[[4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxo-1H-quinolin-6-yl]methyl]phenyl]sulfonylamino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxo-1H-quinolin-6-yl]methyl]phenyl]sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 142967284 |
| Molecular Formula | C31H30F2N2O5S |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | ethyl 3-[[4-[[4-[(E)-1,1-difluorobut-2-enyl]-2-oxo-1H-quinolin-6-yl]methyl]phenyl]sulfonylamino]-3-phenylpropanoate |
| SMILES | C/C=C/C(F)(F)c1cc(=O)[nH]c2ccc(Cc3ccc(S(=O)(=O)NC(CC(=O)OCC)c4ccccc4)cc3)cc12 |
| InChI | InChI=1S/C31H30F2N2O5S/c1-3-16-31(32,33)26-19-29(36)34-27-15-12-22(18-25(26)27)17-21-10-13-24(14-11-21)41(38,39)35-28(20-30(37)40-4-2)23-8-6-5-7-9-23/h3,5-16,18-19,28,35H,4,17,20H2,1-2H3,(H,34,36)/b16-3+ |
| InChIKey | QAOJSVVLTLQEOU-HQYXKAPLSA-N |
| XLogP | 5.76 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|