About 4-methylpenta-1,2,3-triene
4-methylpenta-1,2,3-triene (PubChem CID 14296732) has the molecular formula C6H8
and a molecular weight of 80.13 g/mol. Its IUPAC name is 4-methylpenta-1,2,3-triene.
Molecular Properties
| Compound Name | 4-methylpenta-1,2,3-triene |
| PubChem CID | 14296732 |
| Molecular Formula | C6H8 |
| Molecular Weight | 80.13 g/mol |
| Exact Mass | 80.06 |
| IUPAC Name | 4-methylpenta-1,2,3-triene |
| SMILES | C=C=C=C(C)C |
| InChI | InChI=1S/C6H8/c1-4-5-6(2)3/h1H2,2-3H3 |
| InChIKey | BCLPJYCPKQFYQZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methylpenta-1,2,3-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpenta-1,2,3-triene?
The IUPAC name of 4-methylpenta-1,2,3-triene (CID 14296732) is 4-methylpenta-1,2,3-triene.
What is the SMILES notation for 4-methylpenta-1,2,3-triene?
The canonical SMILES for 4-methylpenta-1,2,3-triene is C=C=C=C(C)C.
What is the InChIKey of 4-methylpenta-1,2,3-triene?
The InChIKey is BCLPJYCPKQFYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8/c1-4-5-6(2)3/h1H2,2-3H3.
What are the key properties of 4-methylpenta-1,2,3-triene?
4-methylpenta-1,2,3-triene has a molecular weight of 80.13 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpenta-1,2,3-triene is sourced from PubChem (CID 14296732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).