About ethane;1-methyl-4-methylidene-1,3-diazinane
ethane;1-methyl-4-methylidene-1,3-diazinane (PubChem CID 142967601) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is ethane;1-methyl-4-methylidene-1,3-diazinane.
Molecular Properties
| Compound Name | ethane;1-methyl-4-methylidene-1,3-diazinane |
| PubChem CID | 142967601 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | ethane;1-methyl-4-methylidene-1,3-diazinane |
| SMILES | C=C1CCN(C)CN1.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-6-3-4-8(2)5-7-6;1-2/h7H,1,3-5H2,2H3;1-2H3 |
| InChIKey | ZUSYIQSNAQAQKT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-4-methylidene-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-methylidene-1,3-diazinane?
The IUPAC name of ethane;1-methyl-4-methylidene-1,3-diazinane (CID 142967601) is ethane;1-methyl-4-methylidene-1,3-diazinane.
What is the SMILES notation for ethane;1-methyl-4-methylidene-1,3-diazinane?
The canonical SMILES for ethane;1-methyl-4-methylidene-1,3-diazinane is C=C1CCN(C)CN1.CC.
What is the InChIKey of ethane;1-methyl-4-methylidene-1,3-diazinane?
The InChIKey is ZUSYIQSNAQAQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C2H6/c1-6-3-4-8(2)5-7-6;1-2/h7H,1,3-5H2,2H3;1-2H3.
What are the key properties of ethane;1-methyl-4-methylidene-1,3-diazinane?
ethane;1-methyl-4-methylidene-1,3-diazinane has a molecular weight of 142.25 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-methylidene-1,3-diazinane is sourced from PubChem (CID 142967601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).