About (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane
(4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane (PubChem CID 142967915) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane.
Molecular Properties
| Compound Name | (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane |
| PubChem CID | 142967915 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane |
| SMILES | C=C1COCO/C1=C/C=C\C.CC |
| InChI | InChI=1S/C9H12O2.C2H6/c1-3-4-5-9-8(2)6-10-7-11-9;1-2/h3-5H,2,6-7H2,1H3;1-2H3/b4-3-,9-5+; |
| InChIKey | KXSUATRDLYMJGF-PIJLWJNCSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane?
The IUPAC name of (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane (CID 142967915) is (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane.
What is the SMILES notation for (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane?
The canonical SMILES for (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane is C=C1COCO/C1=C/C=C\C.CC.
What is the InChIKey of (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane?
The InChIKey is KXSUATRDLYMJGF-PIJLWJNCSA-N. The full InChI is InChI=1S/C9H12O2.C2H6/c1-3-4-5-9-8(2)6-10-7-11-9;1-2/h3-5H,2,6-7H2,1H3;1-2H3/b4-3-,9-5+;.
What are the key properties of (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane?
(4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane has a molecular weight of 182.26 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[(Z)-but-2-enylidene]-5-methylidene-1,3-dioxane;ethane is sourced from PubChem (CID 142967915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).