C22H33NO3 — CID 142968379
(17R)-17-amino-11-hydroxy-10,13-dimethyl-17-propanoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 142968379) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (17R)-17-amino-11-hydroxy-10,13-dimethyl-17-propanoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (17R)-17-amino-11-hydroxy-10,13-dimethyl-17-propanoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142968379 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (17R)-17-amino-11-hydroxy-10,13-dimethyl-17-propanoyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)[C@@]1(N)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C22H33NO3/c1-4-18(26)22(23)10-8-16-15-6-5-13-11-14(24)7-9-20(13,2)19(15)17(25)12-21(16,22)3/h11,15-17,19,25H,4-10,12,23H2,1-3H3/t15?,16?,17?,19?,20?,21?,22-/m0/s1 |
| InChIKey | MFAFZMWXKVOOBB-ODZMLSBPSA-N |
| XLogP | 3.17 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |