About 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine
1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine (PubChem CID 14296893) has the molecular formula C15H24F3N
and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine.
Molecular Properties
| Compound Name | 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine |
| PubChem CID | 14296893 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine |
| SMILES | FC(F)(F)/C(=C\CC1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C15H24F3N/c16-15(17,18)14(19-11-5-2-6-12-19)10-9-13-7-3-1-4-8-13/h10,13H,1-9,11-12H2/b14-10+ |
| InChIKey | MFVZUMBIFVJBGT-GXDHUFHOSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine?
The IUPAC name of 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine (CID 14296893) is 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine.
What is the SMILES notation for 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine?
The canonical SMILES for 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine is FC(F)(F)/C(=C\CC1CCCCC1)N1CCCCC1.
What is the InChIKey of 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine?
The InChIKey is MFVZUMBIFVJBGT-GXDHUFHOSA-N. The full InChI is InChI=1S/C15H24F3N/c16-15(17,18)14(19-11-5-2-6-12-19)10-9-13-7-3-1-4-8-13/h10,13H,1-9,11-12H2/b14-10+.
What are the key properties of 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine?
1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine has a molecular weight of 275.36 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-4-cyclohexyl-1,1,1-trifluorobut-2-en-2-yl]piperidine is sourced from PubChem (CID 14296893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).