C28H28FN3O4S — CID 142969017
cyclopentanecarboxylic acid;4-[3-fluoro-4-[[6-(1-hydroxyethylamino)-1,3-benzothiazol-2-yl]amino]phenyl]benzaldehyde (PubChem CID 142969017) has the molecular formula C28H28FN3O4S and a molecular weight of 521.61 g/mol. Its IUPAC name is cyclopentanecarboxylic acid;4-[3-fluoro-4-[[6-(1-hydroxyethylamino)-1,3-benzothiazol-2-yl]amino]phenyl]benzaldehyde.
| Compound Name | cyclopentanecarboxylic acid;4-[3-fluoro-4-[[6-(1-hydroxyethylamino)-1,3-benzothiazol-2-yl]amino]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 142969017 |
| Molecular Formula | C28H28FN3O4S |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | cyclopentanecarboxylic acid;4-[3-fluoro-4-[[6-(1-hydroxyethylamino)-1,3-benzothiazol-2-yl]amino]phenyl]benzaldehyde |
| SMILES | CC(O)Nc1ccc2nc(Nc3ccc(-c4ccc(C=O)cc4)cc3F)sc2c1.O=C(O)C1CCCC1 |
| InChI | InChI=1S/C22H18FN3O2S.C6H10O2/c1-13(28)24-17-7-9-20-21(11-17)29-22(26-20)25-19-8-6-16(10-18(19)23)15-4-2-14(12-27)3-5-15;7-6(8)5-3-1-2-4-5/h2-13,24,28H,1H3,(H,25,26);5H,1-4H2,(H,7,8) |
| InChIKey | GFEVRABDMITTLD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|