About (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine
(3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine (PubChem CID 142969695) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine |
| PubChem CID | 142969695 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C)F)NC |
| InChI | InChI=1S/C7H10FN/c1-4-7(9-3)5-6(2)8/h4-5,9H,1-2H2,3H3/b7-5+ |
| InChIKey | MDTJURMNWVYVRG-FNORWQNLSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine?
The IUPAC name of (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine (CID 142969695) is (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine.
What is the SMILES notation for (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine?
The canonical SMILES for (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine is C=C/C(=C\C(=C)F)NC.
What is the InChIKey of (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine?
The InChIKey is MDTJURMNWVYVRG-FNORWQNLSA-N. The full InChI is InChI=1S/C7H10FN/c1-4-7(9-3)5-6(2)8/h4-5,9H,1-2H2,3H3/b7-5+.
What are the key properties of (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine?
(3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine has a molecular weight of 127.16 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-fluoro-N-methylhexa-1,3,5-trien-3-amine is sourced from PubChem (CID 142969695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).