About 1-(4-aminopiperidin-1-yl)ethanone;pentane
1-(4-aminopiperidin-1-yl)ethanone;pentane (PubChem CID 142969821) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)ethanone;pentane.
Molecular Properties
| Compound Name | 1-(4-aminopiperidin-1-yl)ethanone;pentane |
| PubChem CID | 142969821 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)ethanone;pentane |
| SMILES | CC(=O)N1CCC(N)CC1.CCCCC |
| InChI | InChI=1S/C7H14N2O.C5H12/c1-6(10)9-4-2-7(8)3-5-9;1-3-5-4-2/h7H,2-5,8H2,1H3;3-5H2,1-2H3 |
| InChIKey | WFWHFBAIJJJAQC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-aminopiperidin-1-yl)ethanone;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminopiperidin-1-yl)ethanone;pentane?
The IUPAC name of 1-(4-aminopiperidin-1-yl)ethanone;pentane (CID 142969821) is 1-(4-aminopiperidin-1-yl)ethanone;pentane.
What is the SMILES notation for 1-(4-aminopiperidin-1-yl)ethanone;pentane?
The canonical SMILES for 1-(4-aminopiperidin-1-yl)ethanone;pentane is CC(=O)N1CCC(N)CC1.CCCCC.
What is the InChIKey of 1-(4-aminopiperidin-1-yl)ethanone;pentane?
The InChIKey is WFWHFBAIJJJAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.C5H12/c1-6(10)9-4-2-7(8)3-5-9;1-3-5-4-2/h7H,2-5,8H2,1H3;3-5H2,1-2H3.
What are the key properties of 1-(4-aminopiperidin-1-yl)ethanone;pentane?
1-(4-aminopiperidin-1-yl)ethanone;pentane has a molecular weight of 214.35 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminopiperidin-1-yl)ethanone;pentane is sourced from PubChem (CID 142969821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).