C39H39N3 — CID 142969905
(1Z,3Z)-5-(2-methylphenyl)octa-1,3,5-trien-1-amine;(1Z,3Z)-4-[(3R)-3-(2-pyridin-2-ylphenyl)-3H-inden-1-yl]buta-1,3-dien-1-amine (PubChem CID 142969905) has the molecular formula C39H39N3 and a molecular weight of 549.76 g/mol. Its IUPAC name is (1Z,3Z)-5-(2-methylphenyl)octa-1,3,5-trien-1-amine;(1Z,3Z)-4-[(3R)-3-(2-pyridin-2-ylphenyl)-3H-inden-1-yl]buta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-(2-methylphenyl)octa-1,3,5-trien-1-amine;(1Z,3Z)-4-[(3R)-3-(2-pyridin-2-ylphenyl)-3H-inden-1-yl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142969905 |
| Molecular Formula | C39H39N3 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (1Z,3Z)-5-(2-methylphenyl)octa-1,3,5-trien-1-amine;(1Z,3Z)-4-[(3R)-3-(2-pyridin-2-ylphenyl)-3H-inden-1-yl]buta-1,3-dien-1-amine |
| SMILES | CCC=C(/C=C\C=C/N)c1ccccc1C.N/C=C\C=C/C1=C[C@@H](c2ccccc2-c2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C24H20N2.C15H19N/c25-15-7-5-9-18-17-23(20-11-2-1-10-19(18)20)21-12-3-4-13-22(21)24-14-6-8-16-26-24;1-3-8-14(10-6-7-12-16)15-11-5-4-9-13(15)2/h1-17,23H,25H2;4-12H,3,16H2,1-2H3/b9-5-,15-7-;10-6-,12-7-,14-8?/t23-;/m1./s1 |
| InChIKey | WZRPYRCKDUUAQP-YMYXPTRQSA-N |
| XLogP | 9.12 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|