About butane;(E)-3,4-dimethylhex-3-ene
butane;(E)-3,4-dimethylhex-3-ene (PubChem CID 142971794) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is butane;(E)-3,4-dimethylhex-3-ene.
Molecular Properties
| Compound Name | butane;(E)-3,4-dimethylhex-3-ene |
| PubChem CID | 142971794 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | butane;(E)-3,4-dimethylhex-3-ene |
| SMILES | CC/C(C)=C(\C)CC.CCCC |
| InChI | InChI=1S/C8H16.C4H10/c1-5-7(3)8(4)6-2;1-3-4-2/h5-6H2,1-4H3;3-4H2,1-2H3/b8-7+; |
| InChIKey | VBCXYSVRIZGKGE-USRGLUTNSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;(E)-3,4-dimethylhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;(E)-3,4-dimethylhex-3-ene?
The IUPAC name of butane;(E)-3,4-dimethylhex-3-ene (CID 142971794) is butane;(E)-3,4-dimethylhex-3-ene.
What is the SMILES notation for butane;(E)-3,4-dimethylhex-3-ene?
The canonical SMILES for butane;(E)-3,4-dimethylhex-3-ene is CC/C(C)=C(\C)CC.CCCC.
What is the InChIKey of butane;(E)-3,4-dimethylhex-3-ene?
The InChIKey is VBCXYSVRIZGKGE-USRGLUTNSA-N. The full InChI is InChI=1S/C8H16.C4H10/c1-5-7(3)8(4)6-2;1-3-4-2/h5-6H2,1-4H3;3-4H2,1-2H3/b8-7+;.
What are the key properties of butane;(E)-3,4-dimethylhex-3-ene?
butane;(E)-3,4-dimethylhex-3-ene has a molecular weight of 170.34 g/mol, XLogP of 4.95, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;(E)-3,4-dimethylhex-3-ene is sourced from PubChem (CID 142971794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).