C23H19FN4O2S — CID 142971907
N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]-N-formylcyclohepta-1,6-dien-4-yne-1-carboxamide (PubChem CID 142971907) has the molecular formula C23H19FN4O2S and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]-N-formylcyclohepta-1,6-dien-4-yne-1-carboxamide.
| Compound Name | N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]-N-formylcyclohepta-1,6-dien-4-yne-1-carboxamide |
|---|---|
| PubChem CID | 142971907 |
| Molecular Formula | C23H19FN4O2S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[[1-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]triazol-4-yl]methyl]-N-formylcyclohepta-1,6-dien-4-yne-1-carboxamide |
| SMILES | O=CN(Cc1cn(-c2ccc(C3=CCSCC3)c(F)c2)nn1)C(=O)C1=CCC#CC=C1 |
| InChI | InChI=1S/C23H19FN4O2S/c24-22-13-20(7-8-21(22)17-9-11-31-12-10-17)28-15-19(25-26-28)14-27(16-29)23(30)18-5-3-1-2-4-6-18/h3,5-9,13,15-16H,4,10-12,14H2 |
| InChIKey | MZSVVJHQHXAVTA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|