C14H20FNS — CID 142972441
2-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentyl-2,3-dihydro-1,3-thiazole (PubChem CID 142972441) has the molecular formula C14H20FNS and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentyl-2,3-dihydro-1,3-thiazole.
| Compound Name | 2-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentyl-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 142972441 |
| Molecular Formula | C14H20FNS |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(4-fluorocyclohexa-1,3-dien-1-yl)-4-pentyl-2,3-dihydro-1,3-thiazole |
| SMILES | CCCCCC1=CSC(C2=CC=C(F)CC2)N1 |
| InChI | InChI=1S/C14H20FNS/c1-2-3-4-5-13-10-17-14(16-13)11-6-8-12(15)9-7-11/h6,8,10,14,16H,2-5,7,9H2,1H3 |
| InChIKey | IMHFULZEISIVFX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|