C11H18N2O — CID 142972458
ethane;4-methoxy-1,2,3,4-tetrahydroquinazoline (PubChem CID 142972458) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;4-methoxy-1,2,3,4-tetrahydroquinazoline.
| Compound Name | ethane;4-methoxy-1,2,3,4-tetrahydroquinazoline |
|---|---|
| PubChem CID | 142972458 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;4-methoxy-1,2,3,4-tetrahydroquinazoline |
| SMILES | CC.COC1NCNc2ccccc21 |
| InChI | InChI=1S/C9H12N2O.C2H6/c1-12-9-7-4-2-3-5-8(7)10-6-11-9;1-2/h2-5,9-11H,6H2,1H3;1-2H3 |
| InChIKey | QTELCDYWMAYKFV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |