C29H39ClN6O3 — CID 142972464
CID 142972464 (PubChem CID 142972464) has the molecular formula C29H39ClN6O3 and a molecular weight of 555.12 g/mol.
| Compound Name | CID 142972464 |
|---|---|
| PubChem CID | 142972464 |
| Molecular Formula | C29H39ClN6O3 |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | — |
| SMILES | NCl.[H]/N=C(/c1c(O)nc(C(CC)N(CCCN)C(=O)c2ccc(C)cc2)n(Cc2ccccc2)c1=O)C(C)C |
| InChI | InChI=1S/C29H37N5O3.ClH2N/c1-5-23(33(17-9-16-30)28(36)22-14-12-20(4)13-15-22)26-32-27(35)24(25(31)19(2)3)29(37)34(26)18-21-10-7-6-8-11-21;1-2/h6-8,10-15,19,23,31,35H,5,9,16-18,30H2,1-4H3;2H2/b31-25+; |
| InChIKey | PPAUYNSARJXZEO-YRFGZABDSA-N |
| XLogP | 4.37 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|