About (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium
(3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium (PubChem CID 142972757) has the molecular formula C6H8N3+
and a molecular weight of 122.15 g/mol. Its IUPAC name is (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium.
Molecular Properties
| Compound Name | (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium |
| PubChem CID | 142972757 |
| Molecular Formula | C6H8N3+ |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium |
| SMILES | C#[N+]C1N=CC=CC1N |
| InChI | InChI=1S/C6H8N3/c1-8-6-5(7)3-2-4-9-6/h1-6H,7H2/q+1 |
| InChIKey | XCSBXJOARINLJE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium?
The IUPAC name of (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium (CID 142972757) is (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium.
What is the SMILES notation for (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium?
The canonical SMILES for (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium is C#[N+]C1N=CC=CC1N.
What is the InChIKey of (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium?
The InChIKey is XCSBXJOARINLJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N3/c1-8-6-5(7)3-2-4-9-6/h1-6H,7H2/q+1.
What are the key properties of (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium?
(3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium has a molecular weight of 122.15 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2,3-dihydropyridin-2-yl)-methylidyneazanium is sourced from PubChem (CID 142972757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).