About 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde
5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde (PubChem CID 142972776) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde.
Molecular Properties
| Compound Name | 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde |
| PubChem CID | 142972776 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde |
| SMILES | C=O.O=c1[nH]ccc2c(N3CCCNCC3)cccc12 |
| InChI | InChI=1S/C14H17N3O.CH2O/c18-14-12-3-1-4-13(11(12)5-7-16-14)17-9-2-6-15-8-10-17;1-2/h1,3-5,7,15H,2,6,8-10H2,(H,16,18);1H2 |
| InChIKey | DWCBVDRQCGVZAE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde?
The IUPAC name of 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde (CID 142972776) is 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde.
What is the SMILES notation for 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde?
The canonical SMILES for 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde is C=O.O=c1[nH]ccc2c(N3CCCNCC3)cccc12.
What is the InChIKey of 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde?
The InChIKey is DWCBVDRQCGVZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O.CH2O/c18-14-12-3-1-4-13(11(12)5-7-16-14)17-9-2-6-15-8-10-17;1-2/h1,3-5,7,15H,2,6,8-10H2,(H,16,18);1H2.
What are the key properties of 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde?
5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde has a molecular weight of 273.34 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-diazepan-1-yl)-2H-isoquinolin-1-one;formaldehyde is sourced from PubChem (CID 142972776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).