About ethane;2-piperidin-1-yl-1,4-dihydropyrimidine
ethane;2-piperidin-1-yl-1,4-dihydropyrimidine (PubChem CID 142973101) has the molecular formula C13H27N3
and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;2-piperidin-1-yl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | ethane;2-piperidin-1-yl-1,4-dihydropyrimidine |
| PubChem CID | 142973101 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | ethane;2-piperidin-1-yl-1,4-dihydropyrimidine |
| SMILES | C1=CNC(N2CCCCC2)=NC1.CC.CC |
| InChI | InChI=1S/C9H15N3.2C2H6/c1-2-7-12(8-3-1)9-10-5-4-6-11-9;2*1-2/h4-5H,1-3,6-8H2,(H,10,11);2*1-2H3 |
| InChIKey | XDAKSWIPPSCNGV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-piperidin-1-yl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-piperidin-1-yl-1,4-dihydropyrimidine?
The IUPAC name of ethane;2-piperidin-1-yl-1,4-dihydropyrimidine (CID 142973101) is ethane;2-piperidin-1-yl-1,4-dihydropyrimidine.
What is the SMILES notation for ethane;2-piperidin-1-yl-1,4-dihydropyrimidine?
The canonical SMILES for ethane;2-piperidin-1-yl-1,4-dihydropyrimidine is C1=CNC(N2CCCCC2)=NC1.CC.CC.
What is the InChIKey of ethane;2-piperidin-1-yl-1,4-dihydropyrimidine?
The InChIKey is XDAKSWIPPSCNGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3.2C2H6/c1-2-7-12(8-3-1)9-10-5-4-6-11-9;2*1-2/h4-5H,1-3,6-8H2,(H,10,11);2*1-2H3.
What are the key properties of ethane;2-piperidin-1-yl-1,4-dihydropyrimidine?
ethane;2-piperidin-1-yl-1,4-dihydropyrimidine has a molecular weight of 225.38 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-piperidin-1-yl-1,4-dihydropyrimidine is sourced from PubChem (CID 142973101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).