About ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile
ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile (PubChem CID 142973633) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile.
Molecular Properties
| Compound Name | ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile |
| PubChem CID | 142973633 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile |
| SMILES | C=C/C=C\C(=C/C)C(O)C#N.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-3-5-6-8(4-2)9(11)7-10;1-2/h3-6,9,11H,1H2,2H3;1-2H3/b6-5-,8-4+; |
| InChIKey | AVMOHWFHWPSXCS-KCWJKURDSA-N |
| XLogP | 2.59 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile?
The IUPAC name of ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile (CID 142973633) is ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile.
What is the SMILES notation for ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile?
The canonical SMILES for ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile is C=C/C=C\C(=C/C)C(O)C#N.CC.
What is the InChIKey of ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile?
The InChIKey is AVMOHWFHWPSXCS-KCWJKURDSA-N. The full InChI is InChI=1S/C9H11NO.C2H6/c1-3-5-6-8(4-2)9(11)7-10;1-2/h3-6,9,11H,1H2,2H3;1-2H3/b6-5-,8-4+;.
What are the key properties of ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile?
ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile has a molecular weight of 179.26 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienenitrile is sourced from PubChem (CID 142973633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).