About 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol
2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol (PubChem CID 14297369) has the molecular formula C22H29N3O
and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol.
Molecular Properties
| Compound Name | 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol |
| PubChem CID | 14297369 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol |
| SMILES | CC(C)(C)Cc1cc(CC(C)(C)C)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H29N3O/c1-21(2,3)13-15-11-16(14-22(4,5)6)20(26)19(12-15)25-23-17-9-7-8-10-18(17)24-25/h7-12,26H,13-14H2,1-6H3 |
| InChIKey | IMJYRYAZVATGLW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol?
The IUPAC name of 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol (CID 14297369) is 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol.
What is the SMILES notation for 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol?
The canonical SMILES for 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol is CC(C)(C)Cc1cc(CC(C)(C)C)c(O)c(-n2nc3ccccc3n2)c1.
What is the InChIKey of 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol?
The InChIKey is IMJYRYAZVATGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O/c1-21(2,3)13-15-11-16(14-22(4,5)6)20(26)19(12-15)25-23-17-9-7-8-10-18(17)24-25/h7-12,26H,13-14H2,1-6H3.
What are the key properties of 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol?
2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol has a molecular weight of 351.49 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-2-yl)-4,6-bis(2,2-dimethylpropyl)phenol is sourced from PubChem (CID 14297369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).