C24H39NO4 — CID 142974181
(6R)-7-[2-[4-(2-ethylcyclopenta-1,3-dien-1-yl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]-6-methylheptanoic acid (PubChem CID 142974181) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is (6R)-7-[2-[4-(2-ethylcyclopenta-1,3-dien-1-yl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]-6-methylheptanoic acid.
| Compound Name | (6R)-7-[2-[4-(2-ethylcyclopenta-1,3-dien-1-yl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]-6-methylheptanoic acid |
|---|---|
| PubChem CID | 142974181 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | (6R)-7-[2-[4-(2-ethylcyclopenta-1,3-dien-1-yl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]-6-methylheptanoic acid |
| SMILES | CCC1=C(CC(O)CCC2CCCC(=O)N2C[C@H](C)CCCCC(=O)O)CC=C1 |
| InChI | InChI=1S/C24H39NO4/c1-3-19-9-6-10-20(19)16-22(26)15-14-21-11-7-12-23(27)25(21)17-18(2)8-4-5-13-24(28)29/h6,9,18,21-22,26H,3-5,7-8,10-17H2,1-2H3,(H,28,29)/t18-,21?,22?/m1/s1 |
| InChIKey | CZPHIQXUYXQLLW-OSFYOIPJSA-N |
| XLogP | 4.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|