About (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid
(4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid (PubChem CID 142974439) has the molecular formula C14H17ClN2O2
and a molecular weight of 280.75 g/mol. Its IUPAC name is (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid.
Molecular Properties
| Compound Name | (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid |
| PubChem CID | 142974439 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid |
| SMILES | C=C(/C=C(/C)C(CC(=O)O)=C(C)C)n1cc(Cl)cn1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-9(2)13(6-14(18)19)10(3)5-11(4)17-8-12(15)7-16-17/h5,7-8H,4,6H2,1-3H3,(H,18,19)/b10-5- |
| InChIKey | XUMFPKNZHXSRRA-YHYXMXQVSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid?
The IUPAC name of (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid (CID 142974439) is (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid.
What is the SMILES notation for (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid?
The canonical SMILES for (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid is C=C(/C=C(/C)C(CC(=O)O)=C(C)C)n1cc(Cl)cn1.
What is the InChIKey of (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid?
The InChIKey is XUMFPKNZHXSRRA-YHYXMXQVSA-N. The full InChI is InChI=1S/C14H17ClN2O2/c1-9(2)13(6-14(18)19)10(3)5-11(4)17-8-12(15)7-16-17/h5,7-8H,4,6H2,1-3H3,(H,18,19)/b10-5-.
What are the key properties of (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid?
(4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid has a molecular weight of 280.75 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-6-(4-chloropyrazol-1-yl)-4-methyl-3-propan-2-ylidenehepta-4,6-dienoic acid is sourced from PubChem (CID 142974439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).