About [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium
[3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium (PubChem CID 142974481) has the molecular formula C8H11F3NO+
and a molecular weight of 194.18 g/mol. Its IUPAC name is [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium.
Molecular Properties
| Compound Name | [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium |
| PubChem CID | 142974481 |
| Molecular Formula | C8H11F3NO+ |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium |
| SMILES | CC1C=C([NH3+])C=CC1OC(F)(F)F |
| InChI | InChI=1S/C8H10F3NO/c1-5-4-6(12)2-3-7(5)13-8(9,10)11/h2-5,7H,12H2,1H3/p+1 |
| InChIKey | ASCYZLOGUWQQOZ-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium?
The IUPAC name of [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium (CID 142974481) is [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium.
What is the SMILES notation for [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium?
The canonical SMILES for [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium is CC1C=C([NH3+])C=CC1OC(F)(F)F.
What is the InChIKey of [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium?
The InChIKey is ASCYZLOGUWQQOZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H10F3NO/c1-5-4-6(12)2-3-7(5)13-8(9,10)11/h2-5,7H,12H2,1H3/p+1.
What are the key properties of [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium?
[3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium has a molecular weight of 194.18 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-4-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]azanium is sourced from PubChem (CID 142974481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).