About 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde
2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde (PubChem CID 142975779) has the molecular formula C15H19N3O4
and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde |
| PubChem CID | 142975779 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde |
| SMILES | CN.COc1ccc(O)c(C(N)=O)c1.O=Cc1ccccn1 |
| InChI | InChI=1S/C8H9NO3.C6H5NO.CH5N/c1-12-5-2-3-7(10)6(4-5)8(9)11;8-5-6-3-1-2-4-7-6;1-2/h2-4,10H,1H3,(H2,9,11);1-5H;2H2,1H3 |
| InChIKey | FNDCBRODGNLPML-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde?
The IUPAC name of 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde (CID 142975779) is 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde.
What is the SMILES notation for 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde?
The canonical SMILES for 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde is CN.COc1ccc(O)c(C(N)=O)c1.O=Cc1ccccn1.
What is the InChIKey of 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde?
The InChIKey is FNDCBRODGNLPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3.C6H5NO.CH5N/c1-12-5-2-3-7(10)6(4-5)8(9)11;8-5-6-3-1-2-4-7-6;1-2/h2-4,10H,1H3,(H2,9,11);1-5H;2H2,1H3.
What are the key properties of 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde?
2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde has a molecular weight of 305.33 g/mol, XLogP of 0.97, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-methoxybenzamide;methanamine;pyridine-2-carbaldehyde is sourced from PubChem (CID 142975779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).