C15H13F2N4OP — CID 142975949
2-[5-[5-[difluoro(phosphanyl)methyl]-2-pyridinyl]-1H-1,2,4-triazol-3-yl]-4-methylphenol (PubChem CID 142975949) has the molecular formula C15H13F2N4OP and a molecular weight of 334.27 g/mol. Its IUPAC name is 2-[5-[5-[difluoro(phosphanyl)methyl]-2-pyridinyl]-1H-1,2,4-triazol-3-yl]-4-methylphenol.
| Compound Name | 2-[5-[5-[difluoro(phosphanyl)methyl]-2-pyridinyl]-1H-1,2,4-triazol-3-yl]-4-methylphenol |
|---|---|
| PubChem CID | 142975949 |
| Molecular Formula | C15H13F2N4OP |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-[5-[5-[difluoro(phosphanyl)methyl]-2-pyridinyl]-1H-1,2,4-triazol-3-yl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(-c2n[nH]c(-c3ccc(C(F)(F)P)cn3)n2)c1 |
| InChI | InChI=1S/C15H13F2N4OP/c1-8-2-5-12(22)10(6-8)13-19-14(21-20-13)11-4-3-9(7-18-11)15(16,17)23/h2-7,22H,23H2,1H3,(H,19,20,21) |
| InChIKey | JANBKDHRXMALDA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|