C20H26F4N2O — CID 142976277
2-(1-aminoethenyl)-4-fluorophenol;(4E,6E)-N,4-dimethyl-7-(trifluoromethyl)nona-4,6,8-trien-3-amine (PubChem CID 142976277) has the molecular formula C20H26F4N2O and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-(1-aminoethenyl)-4-fluorophenol;(4E,6E)-N,4-dimethyl-7-(trifluoromethyl)nona-4,6,8-trien-3-amine.
| Compound Name | 2-(1-aminoethenyl)-4-fluorophenol;(4E,6E)-N,4-dimethyl-7-(trifluoromethyl)nona-4,6,8-trien-3-amine |
|---|---|
| PubChem CID | 142976277 |
| Molecular Formula | C20H26F4N2O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-(1-aminoethenyl)-4-fluorophenol;(4E,6E)-N,4-dimethyl-7-(trifluoromethyl)nona-4,6,8-trien-3-amine |
| SMILES | C=C(N)c1cc(F)ccc1O.C=C/C(=C\C=C(/C)C(CC)NC)C(F)(F)F |
| InChI | InChI=1S/C12H18F3N.C8H8FNO/c1-5-10(12(13,14)15)8-7-9(3)11(6-2)16-4;1-5(10)7-4-6(9)2-3-8(7)11/h5,7-8,11,16H,1,6H2,2-4H3;2-4,11H,1,10H2/b9-7+,10-8+; |
| InChIKey | GOINLBJTPSYNKO-CXDVKTACSA-N |
| XLogP | 5.07 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|