C19H22N4O — CID 142976438
N'-[(1Z,3Z)-1-amino-2-(2-methylidene-1,3-oxazol-3-yl)-1-(4-methylphenyl)hexa-1,3,5-trien-3-yl]ethanimidamide (PubChem CID 142976438) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is N'-[(1Z,3Z)-1-amino-2-(2-methylidene-1,3-oxazol-3-yl)-1-(4-methylphenyl)hexa-1,3,5-trien-3-yl]ethanimidamide.
| Compound Name | N'-[(1Z,3Z)-1-amino-2-(2-methylidene-1,3-oxazol-3-yl)-1-(4-methylphenyl)hexa-1,3,5-trien-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 142976438 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N'-[(1Z,3Z)-1-amino-2-(2-methylidene-1,3-oxazol-3-yl)-1-(4-methylphenyl)hexa-1,3,5-trien-3-yl]ethanimidamide |
| SMILES | C=C/C=C(\N=C(/C)N)C(=C(/N)c1ccc(C)cc1)/N1C=COC1=C |
| InChI | InChI=1S/C19H22N4O/c1-5-6-17(22-14(3)20)19(23-11-12-24-15(23)4)18(21)16-9-7-13(2)8-10-16/h5-12H,1,4,21H2,2-3H3,(H2,20,22)/b17-6-,19-18- |
| InChIKey | MTAUHORRTGFNJP-FXRBOWNYSA-N |
| XLogP | 3.34 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|