About 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol
6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol (PubChem CID 142977779) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol |
| PubChem CID | 142977779 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol |
| SMILES | OCc1ccccc1.[H]/N=C1\CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C11H13N.C7H8O/c1-8-5-6-10-9(7-8)3-2-4-11(10)12;8-6-7-4-2-1-3-5-7/h5-7,12H,2-4H2,1H3;1-5,8H,6H2/b12-11+; |
| InChIKey | MVWIPTXQJHIWKO-CALJPSDSSA-N |
| XLogP | 3.88 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol?
The IUPAC name of 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol (CID 142977779) is 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol.
What is the SMILES notation for 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol?
The canonical SMILES for 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol is OCc1ccccc1.[H]/N=C1\CCCc2cc(C)ccc21.
What is the InChIKey of 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol?
The InChIKey is MVWIPTXQJHIWKO-CALJPSDSSA-N. The full InChI is InChI=1S/C11H13N.C7H8O/c1-8-5-6-10-9(7-8)3-2-4-11(10)12;8-6-7-4-2-1-3-5-7/h5-7,12H,2-4H2,1H3;1-5,8H,6H2/b12-11+;.
What are the key properties of 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol?
6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol has a molecular weight of 267.37 g/mol, XLogP of 3.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-2H-naphthalen-1-imine;phenylmethanol is sourced from PubChem (CID 142977779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).