About 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene
1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene (PubChem CID 142978047) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene.
Molecular Properties
| Compound Name | 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene |
| PubChem CID | 142978047 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene |
| SMILES | CCCC=C(C)/C=C/c1ccc(CCC)cc1 |
| InChI | InChI=1S/C17H24/c1-4-6-8-15(3)9-10-17-13-11-16(7-5-2)12-14-17/h8-14H,4-7H2,1-3H3/b10-9+,15-8? |
| InChIKey | IRPVOKSIFCHYGH-JFVNZWERSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene?
The IUPAC name of 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene (CID 142978047) is 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene.
What is the SMILES notation for 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene?
The canonical SMILES for 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene is CCCC=C(C)/C=C/c1ccc(CCC)cc1.
What is the InChIKey of 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene?
The InChIKey is IRPVOKSIFCHYGH-JFVNZWERSA-N. The full InChI is InChI=1S/C17H24/c1-4-6-8-15(3)9-10-17-13-11-16(7-5-2)12-14-17/h8-14H,4-7H2,1-3H3/b10-9+,15-8?.
What are the key properties of 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene?
1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene has a molecular weight of 228.38 g/mol, XLogP of 5.40, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-3-methylhepta-1,3-dienyl]-4-propylbenzene is sourced from PubChem (CID 142978047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).