C19H28F3NO2S — CID 142978375
N-(3-hydroxysulfanylpropyl)-1-[methoxy-[4-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]cyclohexan-1-amine (PubChem CID 142978375) has the molecular formula C19H28F3NO2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N-(3-hydroxysulfanylpropyl)-1-[methoxy-[4-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]cyclohexan-1-amine.
| Compound Name | N-(3-hydroxysulfanylpropyl)-1-[methoxy-[4-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142978375 |
| Molecular Formula | C19H28F3NO2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-(3-hydroxysulfanylpropyl)-1-[methoxy-[4-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]methyl]cyclohexan-1-amine |
| SMILES | COC(C1=CC=C(C(F)(F)F)CC=C1)C1(NCCCSO)CCCCC1 |
| InChI | InChI=1S/C19H28F3NO2S/c1-25-17(15-7-5-8-16(10-9-15)19(20,21)22)18(11-3-2-4-12-18)23-13-6-14-26-24/h5,7,9-10,17,23-24H,2-4,6,8,11-14H2,1H3 |
| InChIKey | IMBPKZPQUFWVTL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|