C14H18N4 — CID 142978817
8-methylspiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopentane] (PubChem CID 142978817) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 8-methylspiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopentane].
| Compound Name | 8-methylspiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopentane] |
|---|---|
| PubChem CID | 142978817 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 8-methylspiro[3,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-13,1'-cyclopentane] |
| SMILES | Cn1c2c(c3ncncc31)C1(CCCC1)CNC2 |
| InChI | InChI=1S/C14H18N4/c1-18-10-6-15-8-14(4-2-3-5-14)12(10)13-11(18)7-16-9-17-13/h7,9,15H,2-6,8H2,1H3 |
| InChIKey | ZZZWXCSWJMBPRJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |