About 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile
4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile (PubChem CID 14297893) has the molecular formula C14H4N2O2S
and a molecular weight of 264.26 g/mol. Its IUPAC name is 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile |
| PubChem CID | 14297893 |
| Molecular Formula | C14H4N2O2S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile |
| SMILES | N#Cc1sc2c(c1C#N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H4N2O2S/c15-5-9-10(6-16)19-14-11(9)12(17)7-3-1-2-4-8(7)13(14)18/h1-4H |
| InChIKey | GRPSLACDWOFBGV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile?
The IUPAC name of 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile (CID 14297893) is 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile.
What is the SMILES notation for 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile?
The canonical SMILES for 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile is N#Cc1sc2c(c1C#N)C(=O)c1ccccc1C2=O.
What is the InChIKey of 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile?
The InChIKey is GRPSLACDWOFBGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H4N2O2S/c15-5-9-10(6-16)19-14-11(9)12(17)7-3-1-2-4-8(7)13(14)18/h1-4H.
What are the key properties of 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile?
4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile has a molecular weight of 264.26 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dioxobenzo[f][1]benzothiole-2,3-dicarbonitrile is sourced from PubChem (CID 14297893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).