C33H45FN6O3 — CID 142979123
(3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide (PubChem CID 142979123) has the molecular formula C33H45FN6O3 and a molecular weight of 592.76 g/mol. Its IUPAC name is (3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 142979123 |
| Molecular Formula | C33H45FN6O3 |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | (3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,4,4,5-tetramethylcyclohexyl]piperazine-1-carboximidamide |
| SMILES | COc1ccc(CCn2c(=O)[nH]c3cc(N/C(=N/[C@H]4C[C@@H](C)C(C)(C)C[C@@H]4C)N4CCN[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C33H45FN6O3/c1-20-18-33(4,5)21(2)15-28(20)37-31(39-14-12-35-22(3)19-39)36-24-8-10-26-29(16-24)38-32(42)40(30(26)41)13-11-23-7-9-25(43-6)17-27(23)34/h7-10,16-17,20-22,28,35H,11-15,18-19H2,1-6H3,(H,36,37)(H,38,42)/t20-,21+,22-,28-/m0/s1 |
| InChIKey | IXDAETUKUCJBHK-QBMQIYCRSA-N |
| XLogP | 4.60 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|