C15H19N3O2 — CID 142979583
4-[(E)-2-[2-(methoxyamino)phenyl]ethenyl]-5,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 142979583) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[(E)-2-[2-(methoxyamino)phenyl]ethenyl]-5,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 4-[(E)-2-[2-(methoxyamino)phenyl]ethenyl]-5,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 142979583 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[(E)-2-[2-(methoxyamino)phenyl]ethenyl]-5,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CONc1ccccc1/C=C/C1NC(=O)NC(C)=C1C |
| InChI | InChI=1S/C15H19N3O2/c1-10-11(2)16-15(19)17-13(10)9-8-12-6-4-5-7-14(12)18-20-3/h4-9,13,18H,1-3H3,(H2,16,17,19)/b9-8+ |
| InChIKey | FFPFMIWYHUTADU-CMDGGOBGSA-N |
| XLogP | 2.65 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|