About 1-(bromomethyl)-3,3-dimethylcyclohexene
1-(bromomethyl)-3,3-dimethylcyclohexene (PubChem CID 14298041) has the molecular formula C9H15Br
and a molecular weight of 203.12 g/mol. Its IUPAC name is 1-(bromomethyl)-3,3-dimethylcyclohexene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-3,3-dimethylcyclohexene |
| PubChem CID | 14298041 |
| Molecular Formula | C9H15Br |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 1-(bromomethyl)-3,3-dimethylcyclohexene |
| SMILES | CC1(C)C=C(CBr)CCC1 |
| InChI | InChI=1S/C9H15Br/c1-9(2)5-3-4-8(6-9)7-10/h6H,3-5,7H2,1-2H3 |
| InChIKey | IKNCBWRROGDKRH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-3,3-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-3,3-dimethylcyclohexene?
The IUPAC name of 1-(bromomethyl)-3,3-dimethylcyclohexene (CID 14298041) is 1-(bromomethyl)-3,3-dimethylcyclohexene.
What is the SMILES notation for 1-(bromomethyl)-3,3-dimethylcyclohexene?
The canonical SMILES for 1-(bromomethyl)-3,3-dimethylcyclohexene is CC1(C)C=C(CBr)CCC1.
What is the InChIKey of 1-(bromomethyl)-3,3-dimethylcyclohexene?
The InChIKey is IKNCBWRROGDKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Br/c1-9(2)5-3-4-8(6-9)7-10/h6H,3-5,7H2,1-2H3.
What are the key properties of 1-(bromomethyl)-3,3-dimethylcyclohexene?
1-(bromomethyl)-3,3-dimethylcyclohexene has a molecular weight of 203.12 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-3,3-dimethylcyclohexene is sourced from PubChem (CID 14298041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).