C34H34N2OS2 — CID 142980814
2,6-ditert-butyl-4-[[(4-methylphenyl)diazenyl]-(5-thiophen-2-yl-1-benzothiophen-2-yl)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 142980814) has the molecular formula C34H34N2OS2 and a molecular weight of 550.79 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[(4-methylphenyl)diazenyl]-(5-thiophen-2-yl-1-benzothiophen-2-yl)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[[(4-methylphenyl)diazenyl]-(5-thiophen-2-yl-1-benzothiophen-2-yl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142980814 |
| Molecular Formula | C34H34N2OS2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 2,6-ditert-butyl-4-[[(4-methylphenyl)diazenyl]-(5-thiophen-2-yl-1-benzothiophen-2-yl)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | Cc1ccc(/N=N/C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)c2cc3cc(-c4cccs4)ccc3s2)cc1 |
| InChI | InChI=1S/C34H34N2OS2/c1-21-10-13-25(14-11-21)35-36-31(24-18-26(33(2,3)4)32(37)27(19-24)34(5,6)7)30-20-23-17-22(12-15-29(23)39-30)28-9-8-16-38-28/h8-20H,1-7H3/b36-35+ |
| InChIKey | YFELUQZAXMAPBP-ULDVOPSXSA-N |
| XLogP | 10.96 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|