C31H35ClN2OS — CID 142980929
4-[3,3a-dihydro-2-benzothiophen-1-yl-[(2-chloro-5-ethylphenyl)diazenyl]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one (PubChem CID 142980929) has the molecular formula C31H35ClN2OS and a molecular weight of 519.15 g/mol. Its IUPAC name is 4-[3,3a-dihydro-2-benzothiophen-1-yl-[(2-chloro-5-ethylphenyl)diazenyl]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[3,3a-dihydro-2-benzothiophen-1-yl-[(2-chloro-5-ethylphenyl)diazenyl]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142980929 |
| Molecular Formula | C31H35ClN2OS |
| Molecular Weight | 519.15 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-[3,3a-dihydro-2-benzothiophen-1-yl-[(2-chloro-5-ethylphenyl)diazenyl]methylidene]-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| SMILES | CCc1ccc(Cl)c(/N=N/C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C2=C3C=CC=CC3CS2)c1 |
| InChI | InChI=1S/C31H35ClN2OS/c1-8-19-13-14-25(32)26(15-19)33-34-27(29-22-12-10-9-11-20(22)18-36-29)21-16-23(30(2,3)4)28(35)24(17-21)31(5,6)7/h9-17,20H,8,18H2,1-7H3/b34-33+ |
| InChIKey | RGVSDQZEGOAXAO-JEIPZWNWSA-N |
| XLogP | 9.51 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.15 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|