C31H34N2O2S — CID 142980992
2,6-ditert-butyl-4-[[(4-methoxyphenyl)diazenyl]-(3-methyl-2-benzothiophen-1-yl)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 142980992) has the molecular formula C31H34N2O2S and a molecular weight of 498.69 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[(4-methoxyphenyl)diazenyl]-(3-methyl-2-benzothiophen-1-yl)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[[(4-methoxyphenyl)diazenyl]-(3-methyl-2-benzothiophen-1-yl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142980992 |
| Molecular Formula | C31H34N2O2S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 2,6-ditert-butyl-4-[[(4-methoxyphenyl)diazenyl]-(3-methyl-2-benzothiophen-1-yl)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | COc1ccc(/N=N/C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)c2sc(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C31H34N2O2S/c1-19-23-11-9-10-12-24(23)29(36-19)27(33-32-21-13-15-22(35-8)16-14-21)20-17-25(30(2,3)4)28(34)26(18-20)31(5,6)7/h9-18H,1-8H3/b33-32+ |
| InChIKey | VJNXRFDFIWLUSS-ULIFNZDWSA-N |
| XLogP | 9.24 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|