About (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol
(4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol (PubChem CID 142981239) has the molecular formula C8H9FS
and a molecular weight of 156.22 g/mol. Its IUPAC name is (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol.
Molecular Properties
| Compound Name | (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol |
| PubChem CID | 142981239 |
| Molecular Formula | C8H9FS |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol |
| SMILES | FC1=CC=C(CS)CC=C1 |
| InChI | InChI=1S/C8H9FS/c9-8-3-1-2-7(6-10)4-5-8/h1,3-5,10H,2,6H2 |
| InChIKey | PWHHBLJNJBKLEM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol?
The IUPAC name of (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol (CID 142981239) is (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol.
What is the SMILES notation for (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol?
The canonical SMILES for (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol is FC1=CC=C(CS)CC=C1.
What is the InChIKey of (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol?
The InChIKey is PWHHBLJNJBKLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FS/c9-8-3-1-2-7(6-10)4-5-8/h1,3-5,10H,2,6H2.
What are the key properties of (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol?
(4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol has a molecular weight of 156.22 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorocyclohepta-1,3,5-trien-1-yl)methanethiol is sourced from PubChem (CID 142981239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).