About 1-cyclohepta-1,3,5-trien-1-ylethanethiol
1-cyclohepta-1,3,5-trien-1-ylethanethiol (PubChem CID 142981242) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5-trien-1-ylethanethiol.
Molecular Properties
| Compound Name | 1-cyclohepta-1,3,5-trien-1-ylethanethiol |
| PubChem CID | 142981242 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 1-cyclohepta-1,3,5-trien-1-ylethanethiol |
| SMILES | CC(S)C1=CC=CC=CC1 |
| InChI | InChI=1S/C9H12S/c1-8(10)9-6-4-2-3-5-7-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | XFOCOOPYMWBJAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohepta-1,3,5-trien-1-ylethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,3,5-trien-1-ylethanethiol?
The IUPAC name of 1-cyclohepta-1,3,5-trien-1-ylethanethiol (CID 142981242) is 1-cyclohepta-1,3,5-trien-1-ylethanethiol.
What is the SMILES notation for 1-cyclohepta-1,3,5-trien-1-ylethanethiol?
The canonical SMILES for 1-cyclohepta-1,3,5-trien-1-ylethanethiol is CC(S)C1=CC=CC=CC1.
What is the InChIKey of 1-cyclohepta-1,3,5-trien-1-ylethanethiol?
The InChIKey is XFOCOOPYMWBJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12S/c1-8(10)9-6-4-2-3-5-7-9/h2-6,8,10H,7H2,1H3.
What are the key properties of 1-cyclohepta-1,3,5-trien-1-ylethanethiol?
1-cyclohepta-1,3,5-trien-1-ylethanethiol has a molecular weight of 152.26 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,3,5-trien-1-ylethanethiol is sourced from PubChem (CID 142981242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).