About 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol
8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol (PubChem CID 142981816) has the molecular formula C21H30O2S
and a molecular weight of 346.54 g/mol. Its IUPAC name is 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol.
Molecular Properties
| Compound Name | 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol |
| PubChem CID | 142981816 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol |
| SMILES | CC(C)(O)CCCCCCS(=O)c1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C21H30O2S/c1-21(2,22)16-8-3-4-9-17-24(23)20-14-12-19(13-15-20)18-10-6-5-7-11-18/h6,10-15,22H,3-5,7-9,16-17H2,1-2H3 |
| InChIKey | WLKIRGBLOMONJM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol?
The IUPAC name of 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol (CID 142981816) is 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol.
What is the SMILES notation for 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol?
The canonical SMILES for 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol is CC(C)(O)CCCCCCS(=O)c1ccc(C2=CCCC=C2)cc1.
What is the InChIKey of 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol?
The InChIKey is WLKIRGBLOMONJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O2S/c1-21(2,22)16-8-3-4-9-17-24(23)20-14-12-19(13-15-20)18-10-6-5-7-11-18/h6,10-15,22H,3-5,7-9,16-17H2,1-2H3.
What are the key properties of 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol?
8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol has a molecular weight of 346.54 g/mol, XLogP of 5.25, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-cyclohexa-1,5-dien-1-ylphenyl)sulfinyl-2-methyloctan-2-ol is sourced from PubChem (CID 142981816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).