C29H32O — CID 142982007
2-[4-(5-methylidenecyclopenten-1-yl)phenyl]-2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)oxirane (PubChem CID 142982007) has the molecular formula C29H32O and a molecular weight of 396.57 g/mol. Its IUPAC name is 2-[4-(5-methylidenecyclopenten-1-yl)phenyl]-2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)oxirane.
| Compound Name | 2-[4-(5-methylidenecyclopenten-1-yl)phenyl]-2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)oxirane |
|---|---|
| PubChem CID | 142982007 |
| Molecular Formula | C29H32O |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-[4-(5-methylidenecyclopenten-1-yl)phenyl]-2-(3,5,5,8,8-pentamethylnaphthalen-2-yl)oxirane |
| SMILES | C=C1CCC=C1c1ccc(C2(c3cc4c(cc3C)C(C)(C)C=CC4(C)C)CO2)cc1 |
| InChI | InChI=1S/C29H32O/c1-19-8-7-9-23(19)21-10-12-22(13-11-21)29(18-30-29)24-17-26-25(16-20(24)2)27(3,4)14-15-28(26,5)6/h9-17H,1,7-8,18H2,2-6H3 |
| InChIKey | XTLFPBAKVYFBDS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|